|
|
| | 15(R)-Prostaglandin F1α Basic information |
| Product Name: | 15(R)-Prostaglandin F1α | | Synonyms: | 15(R)-Prostaglandin F1α;15beta-PGF1α;15beta-PGF1?±;Prost-13-en-1-oic acid, 9,11,15-trihydroxy-, (9α,11α,13E,15R)- (9CI);9α,11α,15R-trihydroxy-prost-13E-en-1-oic acid;15β-PGF1α | | CAS: | 21562-54-9 | | MF: | C20H36O5 | | MW: | 356.5 | | EINECS: | | | Product Categories: | | | Mol File: | 21562-54-9.mol |  |
| | 15(R)-Prostaglandin F1α Chemical Properties |
| Boiling point | 526.5±50.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 50 mg/ml; DMSO: 50 mg/ml; Ethanol: 50 mg/ml; PBS (pH 7.2): 2 mg/ml | | pka | 4.78±0.10(Predicted) | | form | powder | | InChI | 1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-19,21-23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16-,17-,18+,19-/m1/s1 | | InChIKey | DZUXGQBLFALXCR-HBYHEDERSA-N | | SMILES | O[C@@H]1[C@H](CCCCCCC(O)=O)[C@@H](/C=C/[C@H](O)CCCCC)[C@H](O)C1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Repr. 1B |
| | 15(R)-Prostaglandin F1α Usage And Synthesis |
| Description | 15(R)-Prostaglandin F1α (15(R)-PGF1α) is the C-15 epimer of PGF1α . | | Uses | 15(R)-Prostaglandin F1α (compound 10) is the C-15 epimer of PGF1α[1]. | | References | [1] Pike, John E, et al. Prostanoic acid chemistry. The Journal of Organic Chemistry, 34(11), 3552–3557. |
| | 15(R)-Prostaglandin F1α Preparation Products And Raw materials |
|