| Company Name: |
Alfa Chemistry Gold |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
|
| | Dodecenylsuccinic acid Basic information |
| Product Name: | Dodecenylsuccinic acid | | Synonyms: | Dodecenylsuccinic acid(T746);Dodecylene succinic acid;DODECENDODECENYLSUCCINIC ACIDYLSUCCINIC ACID;2-(Dodecen-1-yl)butanedioic acid;Dodecenylsuccinic acid | | CAS: | 11059-31-7 | | MF: | C16H28O4 | | MW: | 284.39112 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Dodecenylsuccinic acid Chemical Properties |
| InChI | InChI=1S/C16H28O4/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20)/b12-11+ | | InChIKey | QDCPNGVVOWVKJG-VAWYXSNFSA-N | | SMILES | C(O)(=O)C(/C=C/CCCCCCCCCC)CC(O)=O | | CAS DataBase Reference | 11059-31-7 |
| | Dodecenylsuccinic acid Usage And Synthesis |
| Chemical Properties | Pale yellow oily liquid. | | Uses | Dodecenylsuccinic acid mainly used as anti-rust additive for turbine oil and hydraulic oil, with good anti-rust effect |
| | Dodecenylsuccinic acid Preparation Products And Raw materials |
|