| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
|
| | ORACET BLUE Basic information |
| Product Name: | ORACET BLUE | | Synonyms: | LABOTEST-BB LT00847534;ORACET BLUE;ORACET BLUE B;ORACET BLUE B FOR MICROSCOPY;C.I. Solvent Blue 19;1-Anilino-4-(methylamino)anthraquinone, Disperse blue 24, Solvent blue 19;Blue BZL;Solvent blue 19 | | CAS: | 12769-16-3 | | MF: | C21H16N2O2 | | MW: | 328.36 | | EINECS: | 603-233-1 | | Product Categories: | | | Mol File: | 12769-16-3.mol |  |
| | ORACET BLUE Chemical Properties |
| InChI | InChI=1S/C21H16N2O2/c1-22-16-11-12-17(23-13-7-3-2-4-8-13)19-18(16)20(24)14-9-5-6-10-15(14)21(19)25/h2-12,22-23H,1H3 | | InChIKey | TVBNRFCUTVWHQB-UHFFFAOYSA-N | | SMILES | C12C(=O)C3=C(C=CC=C3)C(=O)C1=C(NC)C=CC=2NC1=CC=CC=C1 | | CAS DataBase Reference | 12769-16-3 |
| | ORACET BLUE Usage And Synthesis |
| Uses | C.I. Solvent Blue 19 can be used for multiplex detection of nucleic acids using mixed reporters.It is used in preparation disperse liquid crystal used in display screen. |
| | ORACET BLUE Preparation Products And Raw materials |
|