| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(2-Hydroxyethyl)benzonitrile Basic information |
| | 4-(2-Hydroxyethyl)benzonitrile Chemical Properties |
| Melting point | 50-51°C | | Boiling point | 118 °C | | density | 1.12 | | Fp | 116-118°C/0.5mm | | storage temp. | Sealed in dry,Room Temperature | | form | Powder/Chunks | | pka | 14.72±0.10(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C9H9NO/c10-7-9-3-1-8(2-4-9)5-6-11/h1-4,11H,5-6H2 | | InChIKey | RBSJBNYPTGMZIH-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(CCO)C=C1 | | CAS DataBase Reference | 69395-13-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-22 | | Safety Statements | 26-36/37/39 | | RIDADR | 3439 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 4-(2-Hydroxyethyl)benzonitrile Usage And Synthesis |
| Uses | 4-(2-Hydroxyethyl)benzonitrile is used to produce 4-(2-bromo-ethyl)-benzonitrile. It is used as organic intermediate. | | Definition | ChEBI: 4-(2-Hydroxyethyl)benzonitrile is a member of benzenes and a nitrile. |
| | 4-(2-Hydroxyethyl)benzonitrile Preparation Products And Raw materials |
|