| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(4-Nitrophenoxy)benzoic acid Basic information |
| | 4-(4-Nitrophenoxy)benzoic acid Chemical Properties |
| Melting point | 238-242 °C | | Boiling point | 429.3±25.0 °C(Predicted) | | density | 1.405±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 4.17±0.10(Predicted) | | form | solid | | InChI | 1S/C13H9NO5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,15,16) | | InChIKey | XTVBFFGZCMYUJX-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(Oc2ccc(cc2)[N+]([O-])=O)cc1 | | CAS DataBase Reference | 16309-45-8 |
| Hazard Codes | Xn,N | | Risk Statements | 22-43-50 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 2 | | HazardClass | IRRITANT | | HazardClass | 9 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Skin Sens. 1 |
| | 4-(4-Nitrophenoxy)benzoic acid Usage And Synthesis |
| | 4-(4-Nitrophenoxy)benzoic acid Preparation Products And Raw materials |
|