- copper tpp
-
- $2.00 / 1KG
-
2019-12-31
- CAS:14172-91-9
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20tons
|
| | COPPER TPP Basic information |
| Product Name: | COPPER TPP | | Synonyms: | RARECHEM AS SA 0003;PROTOPORPHYRIN IX CU(II);[5,10,15,20-Tetraphenylporphinato(2-)]copper;21H,23H-Porphine, 5,10,15,20-tetraphenyl-, copper complex;5,10,15,20-Tetraphenylporphinatocopper;Copper tetraphenylporphine;Copper tetraphenylporphyrin;Copper, [5,10,15,20-tetraphenyl-21H,23H-porphinato(2-)-N(21)-,N(22)-,N(23)-,N(24)-]-, (SP-4-1)- | | CAS: | 14172-91-9 | | MF: | C44H28CuN4 | | MW: | 676.27 | | EINECS: | 238-019-3 | | Product Categories: | 1 | | Mol File: | 14172-91-9.mol |  |
| | COPPER TPP Chemical Properties |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | color | Green to Dark green to Dark blue | | Appearance | Green to dark green to dark blue powder crystals | | λmax | 411 nm 536 nm (2nd) | | InChIKey | RKTYLMNFRDHKIL-DAJBKUBHSA-N | | SMILES | N12[Cu]N3C4C=CC3=C(C3C=CC(N=3)=C(C3=CC=CC=C3)C1=CC=C2C(C1=CC=CC=C1)=C1C=CC(C=4C2=CC=CC=C2)=N1)C1=CC=CC=C1 |c:7,14,41,t:36| |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | COPPER TPP Usage And Synthesis |
| Description | Copper(II) meso-Tetraphenylporphyrin (CuTPP) serves as a versatile probe in various sensing applications due to its unique photophysical and electrochemical properties. It has been used as a key component in the development of electrochemical sensors, such as detecting hydroxylamine and chlorogenic acid with high sensitivity and fast response times. Additionally, CuTPP thin films have been employed in optical and electrochemical gas sensors for volatile organic compounds (VOCs), showing significant response to styrene and xylene at room temperature. Its strong absorption and emission characteristics also make it a promising candidate for optical sensors and imaging applications. Overall, CuTPP's ability to interact with specific analytes and its stability under various conditions highlight its potential as a valuable probe in both research and industrial settings. |
| | COPPER TPP Preparation Products And Raw materials |
|