|
|
| | N-Succinimidyl 7-methoxycoumarin-3-carboxylate Basic information | | Preparation |
| Product Name: | N-Succinimidyl 7-methoxycoumarin-3-carboxylate | | Synonyms: | N-Succinimidyl 7-methoxycoumarin-3-carboxylate;7-METHOXYCOUMARIN-3-CARBOXYLIC ACID N-SUCCINIMIDYL ESTER;N-SUCCINIMIDYL 7-METHOXYCOUMARIN-3-CARBOXYLATE;7-METHOXYCOUMARIN-3-CARBOXYLIC ACID N-SUCCINIMIDYL ESTER;7-METHOXYCOUMARIN-3-CARBOXYLIC ACID, SUCCINIMIDYL ESTER;SUCCINIMIDYL 7-METHOXYCOUMARIN-3-CARBOXYLATE;7-Methoxycoumarin-3-carbonic acid N-succinimidyl ester;7-Methoxycoumarin-3-carboxylic acid, succinimidyl ester *CAS 150321-92-9*;2,5-Dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate | | CAS: | 150321-92-9 | | MF: | C15H11NO7 | | MW: | 317.25 | | EINECS: | | | Product Categories: | Coumarines | | Mol File: | 150321-92-9.mol |  |
| | N-Succinimidyl 7-methoxycoumarin-3-carboxylate Chemical Properties |
| storage temp. | −20°C | | solubility | DMF: soluble | | form | powder to crystal | | color | White solid | | λmax | 358 nm (MeOH) | | BRN | 9145767 | | Major Application | Silica particles/beads | | Biological Applications | Analyzing/screening
peptides; monitoring proteolysis; quantifying
analytes;as ligands and/or substrates for transport
proteins;as a substrate formeasuring extracellular matrix
metalloprotease (MMP-1) activity,reverse transcriptase
(RT) polymerase activity, proteases activity;viscosity
sensor;colloidal diagnostic devices;useful for
synthesizing peptides | | InChI | InChI=1S/C15H11NO7/c1-21-9-3-2-8-6-10(14(19)22-11(8)7-9)15(20)23-16-12(17)4-5-13(16)18/h2-3,6-7H,4-5H2,1H3 | | InChIKey | JMQAALOXLOSYCQ-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(OC)=CC=C2C=C1C(ON1C(=O)CCC1=O)=O | | CAS DataBase Reference | 150321-92-9 |
| WGK Germany | 3 | | F | 8-10-21 | | HS Code | 2932.20.4500 |
| | N-Succinimidyl 7-methoxycoumarin-3-carboxylate Usage And Synthesis |
| Preparation | The preparation of N-SUCCINIMIDYL 7-METHOXYCOUMARIN-3-CARBOXYLATE is as follows:
Method 1: Under magnetic stirring, 1 mmol of dimethylformamide (5 ml) and N-hydroxysuccinimide (115 mg, 1 mmol) were added to a solution of 7-methoxycoumarin-3-carboxylic acid. The mixture was cooled to -10 °C and held for 1 hour, and then N,N'-dicyclohexylcarbodiimide (226.96 mg, 1.1 mmol) was added. The mixture was stirred at -10 °C for 1 hour, and then stirred at room temperature for 3 hours. The mixture was then filtered to remove dicyclohexylurea (DCU), and then a mixture of isopropanol/hexane (1/10) was added to precipitate the product. After filtration and vacuum drying, N-SUCCINIMIDYL 7-METHOXYCOUMARIN-3-CARBOXYLATE was obtained. 1H NMR (DMSO-d6)δppm: 8.76 (2H, s); 7.57 (1H, d, J=8.5Hz); 6.95 (1H, d, J=8.5Hz); 6.85 (1H, s); 3.95 (3H, s); 3.34 (2H, s), 2.90 (4H, s). | | Uses | N-Succinimidyl 7-Methoxycoumarin-3-carboxylate is used for labelling neuropeptides and other peptides. | | Uses | 7-Methoxycoumarin-3-carboxylic Acid N-Succinimidyl Ester (cas# 150321-92-9) is a compound useful in organic synthesis. |
| | N-Succinimidyl 7-methoxycoumarin-3-carboxylate Preparation Products And Raw materials |
|