4-CHLORO-6-NITRO-M-CRESOL manufacturers
- 4-CHLORO-6-NITRO-M-CRESOL
-
- $15.00 / 1KG
-
2021-08-12
- CAS:7147-89-9
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-CHLORO-6-NITRO-M-CRESOL Basic information |
| Product Name: | 4-CHLORO-6-NITRO-M-CRESOL | | Synonyms: | 4-CHLORO-6-NITRO-M-CRESOL;4-CHLORO-5-METHYL-2-NITROPHENOL;4-CHLORO-3-METHYL-6-NITROPHENOL;4-chloro-5-methyl-2-nitro-pheno;4-CHLORO-6-NITRO-META-CRESOL, 99%;4-CHLORO-6-NITRO-M-CRESOL,99%;4-chloro-5-methyl-2-nitrophenolate;4-CHLORO-6-NITRO-METALPHA-CRESOL 99% | | CAS: | 7147-89-9 | | MF: | C7H6ClNO3 | | MW: | 187.58 | | EINECS: | 230-461-5 | | Product Categories: | | | Mol File: | 7147-89-9.mol |  |
| | 4-CHLORO-6-NITRO-M-CRESOL Chemical Properties |
| Melting point | 132-134 °C(lit.) | | Boiling point | 276.7±35.0 °C(Predicted) | | density | 1.4219 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | RT, stored under nitrogen | | pka | 6.51±0.27(Predicted) | | form | powder to crystal | | color | Light yellow to Amber to Dark green | | Henry's Law Constant | 3.6×10-1 mol/(m3Pa) at 25℃, Schwarzenbach et al. (1988) | | InChI | 1S/C7H6ClNO3/c1-4-2-7(10)6(9(11)12)3-5(4)8/h2-3,10H,1H3 | | InChIKey | JBMGJOKJUYGIJH-UHFFFAOYSA-N | | SMILES | Cc1cc(O)c(cc1Cl)[N+]([O-])=O | | CAS DataBase Reference | 7147-89-9(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 4-chloro-5-methyl-2-nitro- (7147-89-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29089990 | | Storage Class | 11 - Combustible Solids |
| | 4-CHLORO-6-NITRO-M-CRESOL Usage And Synthesis |
| Chemical Properties | yellow to greenish powder | | Uses | 4-Chloro-3-methyl-6-nitrophenol was used to evaluate toxicity in Tetrahymena pyriformis by quantitative structure-toxicity relationships-topological substructural molecular design method. |
| | 4-CHLORO-6-NITRO-M-CRESOL Preparation Products And Raw materials |
|