|
|
| | 6-Iodo-3 H-isobenzofuran-1-one Basic information |
| Product Name: | 6-Iodo-3 H-isobenzofuran-1-one | | Synonyms: | 6-IODOISOBENZOFURAN-1(3H)-ONE;6-iodo-1,3-dihydro-2-benzofuran-1-one;6-iodo-1(3H)-Isobenzofuranone;6-Iodophthalide;6-iodo-3H-2-benzofuran-1-one;6-Iodoisobenzofuran-1(3H);1(3H)-Isobenzofuranone, 6-iodo-;6-Iodo-1(3H)-isobenzofuranone, 95+% | | CAS: | 53910-10-4 | | MF: | C8H5IO2 | | MW: | 260.03 | | EINECS: | | | Product Categories: | | | Mol File: | 53910-10-4.mol |  |
| | 6-Iodo-3 H-isobenzofuran-1-one Chemical Properties |
| Melting point | 103 °C | | Boiling point | 382.7±42.0 °C(Predicted) | | density | 2.029±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C8H5IO2/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3H,4H2 | | InChIKey | GDWUNKJJSAKJSC-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC(I)=C2)CO1 | | CAS DataBase Reference | 53910-10-4 |
| | 6-Iodo-3 H-isobenzofuran-1-one Usage And Synthesis |
| | 6-Iodo-3 H-isobenzofuran-1-one Preparation Products And Raw materials |
|