|
|
| | AKOS 212-44 Basic information |
| Product Name: | AKOS 212-44 | | Synonyms: | AKOS 212-44;AURORA 684;4,5,6-TRIMETHOXY-3H-ISOBENZOFURAN-1-ONE;4,5,6-trimethoxy-3H-2-benzofuran-1-one;Nsc26223;4,5,6-TriMethoxyisobenzofuran-1(3H)-one;4,5,6-trimethoxy-1(3H)-Isobenzofuranone;TIMTEC-BB SBB009984 | | CAS: | 4087-80-3 | | MF: | C11H12O5 | | MW: | 224.21 | | EINECS: | | | Product Categories: | | | Mol File: | 4087-80-3.mol |  |
| | AKOS 212-44 Chemical Properties |
| Melting point | 134.7-135.7 °C | | Boiling point | 287.0±7.0 °C(Predicted) | | density | 1.259±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C11H12O5/c1-13-8-4-6-7(5-16-11(6)12)9(14-2)10(8)15-3/h4H,5H2,1-3H3 | | InChIKey | SRBRUXANGPVKMN-UHFFFAOYSA-N | | SMILES | O=C1C2=CC(OC)=C(OC)C(OC)=C2CO1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | AKOS 212-44 Usage And Synthesis |
| | AKOS 212-44 Preparation Products And Raw materials |
|