| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| Product Name: | BEC | | Synonyms: | BEC;S-(2-BORONOETHYL)-L-CYSTEINE;L-Cysteine, S-(2-boronoethyl)-;(2S)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid;Arginase II(BEC hydrochloride);BEC, Arginase inhibitor;Bec1;CLDN | | CAS: | 63107-40-4 | | MF: | C5H12BNO4S | | MW: | 193.03 | | EINECS: | | | Product Categories: | | | Mol File: | 63107-40-4.mol |  |
| Boiling point | 451.6±55.0 °C(Predicted) | | density | 1.372±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | PBS (pH 7.2): 5 mg/ml | | form | powder | | pka | 2.10±0.10(Predicted) | | color | white to beige | | Water Solubility | H2O: 20mg/mL, clear | | InChI | 1S/C5H12BNO4S.CH4/c7-4(5(8)9)3-12-2-1-6(10)11;/h4,10-11H,1-3,7H2,(H,8,9);1H4/t4-;/m0./s1 | | InChIKey | IMYJQAMXIIYUIH-WCCKRBBISA-N | | SMILES | OB(O)CCSC[C@H](N)C(O)=O.C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Uses | L-Arginine serves as a common substrate for both nitric oxide synthase (NOS) and arginase in the cell. NOS catalyzes the oxidation of arginine to citrulline and NO with Nω-hydroxy-L-arginine (NOHA) formed as an intermediate. Arginase, on the other hand, catalyzes the hydrolysis of arginine into urea and L-ornithine. BEC is a potent slow-binding competitive inhibitor of recombinant rat liver arginase I with a Ki of 0.4-0.6 μM. It is also a potent inhibitor of human arginase II with Ki values of 0.31 μM and 30 nM at pH 7.5 and 9.5, respectively. It does not inhibit murine iNOS at concentrations up to 1 mM. BEC significantly enhances NO-dependent relaxation of human penile corpus canvernosum smooth muscle in vitro at concentrations between 0.1-1.0 mM. | | Definition | ChEBI: S-(2-boronoethyl)-L-cysteine is l-cysteine substituted at sulfur by a 2-boronoethyl group. It is an organoboron compound, a L-cysteine thioether and a non-proteinogenic L-alpha-amino acid. | | Biochem/physiol Actions | BEC (S-(2-boronoethyl)-l-cysteine) is a potent and specific arginase inhibitor that restores flow-induced responses in arterioles from diabetic rats. | | Enzyme inhibitor | This boronic acid-containing arginine analogue (FW = 190.00 g/mol; CAS 63107-40-4; Abbreviation: BEC) is a slow, tight-binding competitive inhibitor of arginase (Reaction: L-Arginine + H2O Urea + L-Ornithine), the binuclear manganese metalloenzyme catalyzing the last step in the Urea Cycle. Upon binding, the boronic acid moiety undergoes nucleophilic attack by the enzyme’s metal-bridging hydroxide ion, yielding a tetrahedral boronate anion that bridges the binuclear manganese cluster and mimics the tetrahedral intermediate (or a flanking transition state configuration) in arginase catalysis. BEC is also a potent inhibitor of human arginase II with Ki values of 0.31 μM and 30 nM at pH 7.5 and 9.5, respectively. Inhibition of arginase by BEC increases the circulating concentration of arginine, thereby increasing nitric oxide synthesis and significantly enhancing NO-dependent smooth muscle relaxation in human penile corpus cavernosum. Arginase is thus a potential druggable target for the treatment of erectile dysfunction. |
| | BEC Preparation Products And Raw materials |
|