Isonicotinic acid (2-hydroxy-benzylidene)-hydrazide manufacturers
- Salinazid
-
- $29.00
-
2026-05-11
- CAS:495-84-1
- Purity: 99.92%
- Supply Ability: 10g
|
| | Isonicotinic acid (2-hydroxy-benzylidene)-hydrazide Basic information |
| | Isonicotinic acid (2-hydroxy-benzylidene)-hydrazide Chemical Properties |
| Melting point | 232-233° (also given as 251°) | | storage temp. | -196°C | | solubility | DMF: 10 mg/ml,DMF:PBS (pH 7.2) (1:3): 0.23 mg/ml,DMSO: 5 mg/ml | | form | A crystalline solid | | color | White to off-white | | InChI | InChI=1S/C13H11N3O2/c17-12-4-2-1-3-11(12)9-15-16-13(18)10-5-7-14-8-6-10/h1-9,17H,(H,16,18) | | InChIKey | VBIZUNYMJSPHBH-UHFFFAOYSA-N | | SMILES | C1=NC=CC(C(NN=CC2=CC=CC=C2O)=O)=C1 | | CAS DataBase Reference | 495-84-1(CAS DataBase Reference) |
| | Isonicotinic acid (2-hydroxy-benzylidene)-hydrazide Usage And Synthesis |
| Uses | Salinazid is an antituberculous compound[1]. | | Definition | ChEBI: Salinazid is an aromatic carboxylic acid and a pyridinemonocarboxylic acid. | | Brand name | Salizid (Parke-Davis). | | Purification Methods | Crystallise it from EtOH (m 265-266o or 244-245o), aqueous EtOH or MeOH (252-253o) and dry it in a vacuum at 100o. [Beilstein 22 III/IV 584.] | | References | [1] Blokhina, Svetlana, et al. Antituberculous isoniazid and some related compounds: solubility in pharmaceutically significant solvents and sublimation. |
| | Isonicotinic acid (2-hydroxy-benzylidene)-hydrazide Preparation Products And Raw materials |
|