| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4,6-Trifluorophenylhydrazine Basic information |
| Product Name: | 2,4,6-Trifluorophenylhydrazine | | Synonyms: | 2,4,6-Trifluorophenylhydrazine97+%;2,4,6-Trifluorophenylhydrazine80025-72-5;1-Hydrazino-2,4,6-trifluorobenzene;2-Hydrazino-1,3,5-trifluorobenzene;Hydrazine, (2,4,6-trifluorophenyl)-;2,4,6-Trifluorophenylhydrazine | | CAS: | 80025-72-5 | | MF: | C6H5F3N2 | | MW: | 162.11 | | EINECS: | | | Product Categories: | Aromatic Hydrazides, Hydrazines, Hydrazones and Oximes | | Mol File: | 80025-72-5.mol |  |
| | 2,4,6-Trifluorophenylhydrazine Chemical Properties |
| Melting point | 97-99°C | | Boiling point | 142.4±40.0 °C(Predicted) | | density | 1.491±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 4.31±0.33(Predicted) | | color | Nearly white | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C6H5F3N2/c7-3-1-4(8)6(11-10)5(9)2-3/h1-2,11H,10H2 | | InChIKey | KSKADWHKCXNUAA-UHFFFAOYSA-N | | SMILES | N(C1=C(F)C=C(F)C=C1F)N | | CAS DataBase Reference | 80025-72-5(CAS DataBase Reference) |
| | 2,4,6-Trifluorophenylhydrazine Usage And Synthesis |
| Uses | Propionic acid (2,4,6-trichlorophenyl)hydrazide was prepared by reaction of (2,4,6-trichlorophenyl)- hydrazine with propionyl chloride in pyridine. Visnaginone Ia reacted with phenyl hydrazine and 2,4,6- trichlorophenyl hydrazine to yield the corresponding hydrazones. |
| | 2,4,6-Trifluorophenylhydrazine Preparation Products And Raw materials |
|