|
|
| | Diethyl (2-oxo-2-phenylethyl)phosphonate Basic information |
| | Diethyl (2-oxo-2-phenylethyl)phosphonate Chemical Properties |
| Boiling point | 192-193 °C/11 mmHg (lit.) | | density | 1.179 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.513(lit.) | | Fp | >230 °F | | form | clear liquid | | color | White to Yellow to Green | | InChI | 1S/C12H17O4P/c1-3-15-17(14,16-4-2)10-12(13)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 | | InChIKey | HPEVTTNSIPGLEL-UHFFFAOYSA-N | | SMILES | CCOP(=O)(CC(=O)c1ccccc1)OCC | | CAS DataBase Reference | 3453-00-7 |
| WGK Germany | 3 | | HS Code | 2931499090 | | Storage Class | 10 - Combustible liquids |
| | Diethyl (2-oxo-2-phenylethyl)phosphonate Usage And Synthesis |
| Uses | Reactant involved in:
- Asymmetric Michael addition of β-oxo phosphonates to nitro olefins
- Gem-chlorofluorination of keto phosphonates with subsequent functionalization of the products
- Cyclocondensation reactions to produce arylphosphonates
- Diazo transfer reactions for synthesis of diazo-phosphonyl compounds
- Horner-Wadsworth-Emmons reactions
- Inverse-electron-demand Diels-Alder reactions
| | Synthesis Reference(s) | Synthetic Communications, 26, p. 2561, 1996 DOI: 10.1080/00397919608004568 | | reaction suitability | reaction type: C-C Bond Formation |
| | Diethyl (2-oxo-2-phenylethyl)phosphonate Preparation Products And Raw materials |
|