|
|
| | 12(S)-HHT Basic information |
| Product Name: | 12(S)-HHT | | Synonyms: | (12S,5Z,8E,10E)-12-Hydroxy-5,8,10-heptadecatrienoic acid;(5Z,8E,10E,12S)-12-Hydroxy-5,8,10-heptadecatrienoic acid;12(S)-HHTrE Lipid Maps MS Standard;KUKJHGXXZWHSBG-WBGSEQOASA-N;12(S)-hydroxy-5(Z),8(E),10(E)-*heptadecatrienoic;12(S)-HYDROXY-5(Z),8(E),10(E)-*HEPTADECA TRIENOIC AC;12(S)-HYDROXYHEPTADECA-5Z,8E,10E-TRIENOIC ACID;12(S)-HYDROXY-(5Z,8E,10E)-HEPTADECATRIENOIC ACID | | CAS: | 54397-84-1 | | MF: | C17H28O3 | | MW: | 280.4 | | EINECS: | | | Product Categories: | | | Mol File: | 54397-84-1.mol |  |
| | 12(S)-HHT Chemical Properties |
| Boiling point | 451.8±45.0 °C(Predicted) | | density | 0.992±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | 0.1 M Na2CO3: 2 mg/ml; DMF: Miscible; DMSO: Miscible; Ethanol: Miscible; PBS pH 7.2: 0.8 mg/ml | | form | ethanol solution | | pka | 4.75±0.10(Predicted) | | color | Colorless to light yellow | | biological source | synthetic (organic) | | InChI | 1S/C17H28O3/c1-2-3-10-13-16(18)14-11-8-6-4-5-7-9-12-15-17(19)20/h5-8,11,14,16,18H,2-4,9-10,12-13,15H2,1H3,(H,19,20)/b7-5-,8-6+,14-11+/t16-/m0/s1 | | InChIKey | KUKJHGXXZWHSBG-WBGSEQOASA-N | | SMILES | CCCCC[C@H](O)\C=C\C=C\C\C=C/CCCC(O)=O |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1170 3/PG 2 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 12(S)-HHT Usage And Synthesis |
| Uses | 12(S)-HHTrE is an unusual product of the cyclooxygenase (COX) pathway and one of the primary arachidonic acid metabolites of the human platelet. It is biosynthesized by thromboxane synthase (TX synthase) from prostaglandin H2 (PGH2) concurrently with TXA2. The biological role of 12(S)-HHTrE is uncertain. It is avidly oxidized to 12-oxoHTrE by porcine 15-hydroxy PGDH. | | Uses | 12(S)-HHTrE is a metabolite of arachidonic acid (A765000), which is an essential fatty acid and a precursor in the biosynthesis of prostaglandins, thromboxanes, and leukotrienes. Arachidonic Acid occurs in liver, brain, glandular organs, and depot fats of animals, in small amounts in human depot fats, and Arachidonic Acid is also a constituent of animal phosphatides. | | Definition | ChEBI: A trienoic fatty acid that consists of (5Z,8E,10E)-heptadeca-5,8,10-trienoic acid bearing an additional 12S-hydroxy substituent. | | IC 50 | Human Endogenous Metabolite; BLT2 |
| | 12(S)-HHT Preparation Products And Raw materials |
|