| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | Lauric acid-1,2,3,4-13C4 Basic information |
| Product Name: | Lauric acid-1,2,3,4-13C4 | | Synonyms: | Dodecanoic acid-1,2,3,4-13C4;Lauric acid-1,2,3,4-13C4;Dodecanoic-1,2,3,4-13C4 acid;Lauric acid-1,2,3,4-13C4 | | CAS: | 287111-14-2 | | MF: | C12H24O2 | | MW: | 204.35 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Lauric acid-1,2,3,4-13C4 Chemical Properties |
| Melting point | 44-46 °C(lit.) | | Boiling point | 225 °C/100 mmHg(lit.) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/i9+1,10+1,11+1,12+1 | | InChIKey | POULHZVOKOAJMA-BMHINFNASA-N | | SMILES | O[13C]([13CH2][13CH2][13CH2]CCCCCCCC)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | Lauric acid-1,2,3,4-13C4 Usage And Synthesis |
| | Lauric acid-1,2,3,4-13C4 Preparation Products And Raw materials |
|