- 9-Octadecenoic acid
-
- $1.00
-
2020-02-01
- CAS:1937-62-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | ELAIDIC ACID METHYL ESTER Basic information |
| | ELAIDIC ACID METHYL ESTER Chemical Properties |
| Melting point | 9-10 °C | | Boiling point | 220 °C / 24mmHg | | density | 0.871 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.452 | | Fp | -3℃ | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | liquid | | color | Clear Colourless | | BRN | 1727038 | | InChI | 1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h10-11H,3-9,12-18H2,1-2H3/b11-10+ | | InChIKey | QYDYPVFESGNLHU-ZHACJKMWSA-N | | SMILES | CCCCCCCC\C=C\CCCCCCCC(=O)OC | | LogP | 8.160 (est) | | CAS DataBase Reference | 1937-62-8(CAS DataBase Reference) | | EPA Substance Registry System | 9-Octadecenoic acid, methyl ester, (9E)- (1937-62-8) |
| | ELAIDIC ACID METHYL ESTER Usage And Synthesis |
| Chemical Properties | Colorless liquid. Insoluble in water; soluble in mostorganic solvents. Combustible. | | Uses | ELAIDIC ACID METHYL ESTER is a pure grade (99+%) used in biochemicalresearch. | | Uses | Elaidic Acid Methyl Ester is an intermediate used to prepare ±)-trans-9,10-Epoxystearic Acid Methyl Ester. | | Definition | The methyl ester of elaidic acid (trans-octadec-9-enoic acid). | | Synthesis Reference(s) | The Journal of Organic Chemistry, 43, p. 2076, 1978 DOI: 10.1021/jo00404a059 |
| | ELAIDIC ACID METHYL ESTER Preparation Products And Raw materials |
|