(2-Aminoethyl)trimethylammonium chloride hydrochloride manufacturers
|
| | (2-Aminoethyl)trimethylammonium chloride hydrochloride Basic information |
| Product Name: | (2-Aminoethyl)trimethylammonium chloride hydrochloride | | Synonyms: | (2-Aminoethyl)trimethylammonium chloride HCl;2-AMINOETHYLTRIMETHYLAMMONIUM CHLORIDEHY DROCHLORID;(2-Aminoethyl)trimethylammoniumchlorideHCl,purum;(2-Aminoethyl)trimethylammoniumchloridehydrochloridepurum;(2-AMINOETHYL)TRIMETHYLAMMONIUM CHLORIDE HYDROCHLORIDE PURUM 97%;(2-Aminoethyl)trimethylammonium chloride hydrochloride purum, >=97.0% (T);Cholamine chloride;(2-Amino-ethyl)-trimethyl-ammoniumchloride | | CAS: | 3399-67-5 | | MF: | C5H16Cl2N2 | | MW: | 175.1 | | EINECS: | 222-266-9 | | Product Categories: | | | Mol File: | 3399-67-5.mol |  |
| | (2-Aminoethyl)trimethylammonium chloride hydrochloride Chemical Properties |
| Melting point | 260 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | Appearance | White to yellow Solid | | BRN | 3730048 | | InChI | InChI=1S/C5H15N2.2ClH/c1-7(2,3)5-4-6;;/h4-6H2,1-3H3;2*1H/q+1;;/p-1 | | InChIKey | GJBYCNLSIBQCRF-UHFFFAOYSA-M | | SMILES | C(CN)[N+](C)(C)C.Cl.[Cl-] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (2-Aminoethyl)trimethylammonium chloride hydrochloride Usage And Synthesis |
| Uses | (2-Aminoethyl)trimethylammonium chloride hydrochloride can be used as ′fixed charge′ chemical derivatization reagent to structurally modify peptides and polymers. | | Purification Methods | Crystallise the hydrochloride from EtOH. The material is very soluble in H2O. [Beilstein 4 II 690.] |
| | (2-Aminoethyl)trimethylammonium chloride hydrochloride Preparation Products And Raw materials |
|