| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1-(2,4,6-Trichlorophenyl)-2-thiourea manufacturers
|
| | 1-(2,4,6-Trichlorophenyl)-2-thiourea Basic information |
| Product Name: | 1-(2,4,6-Trichlorophenyl)-2-thiourea | | Synonyms: | N-(2,4,6-TRICHLOROPHENYL)THIOUREA;1-(2,4,6-Trichlorophenyl)thiourea;2,4,6-TRICHLOROPHENYLTHIOUREA;Thiourea, N-(2,4,6-trichlorophenyl)-;N-(2,4,6-Trichlorophenyl)thiourea;1-(2,4,6-Trichlorophenyl)-2-thiourea | | CAS: | 31118-87-3 | | MF: | C7H5Cl3N2S | | MW: | 255.55 | | EINECS: | 202-110-6 | | Product Categories: | Organic Building Blocks;Sulfur Compounds;Thioureas | | Mol File: | 31118-87-3.mol |  |
| | 1-(2,4,6-Trichlorophenyl)-2-thiourea Chemical Properties |
| Melting point | 206-211 °C(lit.) | | form | solid | | InChI | 1S/C7H5Cl3N2S/c8-3-1-4(9)6(5(10)2-3)12-7(11)13/h1-2H,(H3,11,12,13) | | InChIKey | ZUSZPZPGZMEXLA-UHFFFAOYSA-N | | SMILES | NC(=S)Nc1c(Cl)cc(Cl)cc1Cl | | CAS DataBase Reference | 31118-87-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36 | | WGK Germany | 3 | | HazardClass | 6.1 | | HazardClass | IRRITANT | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 1-(2,4,6-Trichlorophenyl)-2-thiourea Usage And Synthesis |
| | 1-(2,4,6-Trichlorophenyl)-2-thiourea Preparation Products And Raw materials |
|