| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
|
| | Bisphenol a ethoxylate dimethacrylate Basic information |
| Product Name: | Bisphenol a ethoxylate dimethacrylate | | Synonyms: | 2,2-BIS-[4-(METHACRYLOXYPOLYETHOXY)-PHENYL]-PROPANE;ETHOXYLATED (4) BISPHENOL A DIMETHACRYLATE;Bisphenol A bis-(2-hydroxyethyl)-ether dimethacrylate;Bis(2-methylpropenoic acid)(1-methylethylidene)bis(4,1-phenyleneoxy-2,1-ethanediyl) ester;Bis-MEPP;Bismethacrylic acid [(dimethylmethylene)bis(4,1-phenyleneoxyethylene)] ester;Bismethacrylic acid [isopropylidenebis(4,1-phenylene)bisoxybisethylene] ester;Bismethacrylic acid isopropylidenebis(p-phenyleneoxyethylene) ester | | CAS: | 24448-20-2 | | MF: | C27H32O6 | | MW: | 452.54 | | EINECS: | 246-263-7 | | Product Categories: | | | Mol File: | 24448-20-2.mol |  |
| | Bisphenol a ethoxylate dimethacrylate Chemical Properties |
| Melting point | 44-45 °C | | Boiling point | 574.6±50.0 °C(Predicted) | | density | 1.12 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.532 | | Fp | >230 °F | | InChI | InChI=1S/C27H32O6/c1-19(2)25(28)32-17-15-30-23-11-7-21(8-12-23)27(5,6)22-9-13-24(14-10-22)31-16-18-33-26(29)20(3)4/h7-14H,1,3,15-18H2,2,4-6H3 | | InChIKey | VIYWVRIBDZTTMH-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(OCCOC(=O)C(C)=C)C=C1)(C1=CC=C(OCCOC(=O)C(C)=C)C=C1)(C)C | | CAS DataBase Reference | 24448-20-2 | | EPA Substance Registry System | Bisphenol A bis(2-hydroxyethyl ether) dimethacrylate (24448-20-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed |
| | Bisphenol a ethoxylate dimethacrylate Usage And Synthesis |
| Uses | 2,2-bis(4-(2-Methacryloxyethoxy)-phenyl)propane is used in dental restorative composite materials; reactive monomer in adhesive products. |
| | Bisphenol a ethoxylate dimethacrylate Preparation Products And Raw materials |
|