|
|
| | cis-Dichlorobis(diethylsulfide)platinum(II) Basic information | | Uses |
| Product Name: | cis-Dichlorobis(diethylsulfide)platinum(II) | | Synonyms: | TRANS-DICHLOROBIS(DIETHYLSULFIDE)PLATINUM(II);DICHLOROBIS(DIETHYLSULPHIDE)PLATINATE (II);CIS-BIS(DIETHYL SULFIDE)PLATINUM(II) CHLORIDE;CIS-DICHLOROBIS(DIETHYLSULFIDE)PLATINUM(II);cis-Dichlorobis(diethylsulfide)platinum(II),Pt43.7%;cis-Dichlorobis(diethylsulfide)platinum(II),99%;DICHLOROBIS(DIETHYLSULFIDE)PLATINUM(II);cis-Dichlorobis-(diethyl sulfide)-platinum | | CAS: | 15442-57-6 | | MF: | C8H22Cl2PtS2 | | MW: | 448.37 | | EINECS: | 239-454-1 | | Product Categories: | Pt | | Mol File: | 15442-57-6.mol |  |
| | cis-Dichlorobis(diethylsulfide)platinum(II) Chemical Properties |
| Melting point | 105 °C(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Soluble in acetone, alcohol and benzene | | form | Powder | | color | yellow | | Water Solubility | slightly soluble | | Exposure limits | ACGIH: TWA 0.002 mg/m3 NIOSH: IDLH 4 mg/m3; TWA 0.002 mg/m3 | | InChI | InChI=1S/2C4H10S.2ClH.Pt/c2*1-3-5-4-2;;;/h2*3-4H2,1-2H3;2*1H; | | InChIKey | UHBPKZLROHZYIJ-UHFFFAOYSA-N | | SMILES | [Pt+2]([Cl-])([Cl-])(S(CC)CC)S(CC)CC | | CAS DataBase Reference | 15442-57-6(CAS DataBase Reference) |
| | cis-Dichlorobis(diethylsulfide)platinum(II) Usage And Synthesis |
| Uses | Cis-dichlorodi(diethyl sulfide)platinum(II) is a platinum homogeneous catalyst. Hydrosilylation is an important reaction that produces various organosilicon compounds, and platinum homogeneous catalysts are the most common catalysts for this type of reaction. | | Description | Cis-Dichlorobis(diethylsulfide)platinum(II) is a chemical reagent that can prepare other platinum compounds. It is a colorless solid with a melting point of 173°C. cis-Dichlorobis(diethylsulfide)platinum(II) has been used in the synthesis of benzenesulfonyl chloride and benzene, which are essential intermediates for the production of pharmaceuticals such as carbapenems and fluoroquinolones. cis-Dichlorobis(diethylsulfide)platinum(II) also has an isomerization reaction with lithium, ether, or sulfide to yield cis-Dichlorobis(ethylsulfide)platinum (II).
| | Chemical Properties | Yellow-green powder | | reaction suitability | core: platinum reagent type: catalyst |
| | cis-Dichlorobis(diethylsulfide)platinum(II) Preparation Products And Raw materials |
|