| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| Product Name: | ACA | | Synonyms: | AMARANTHUS CAUDATUS LECTIN;ACA;2-[[1-oxo-3-(4-Pentylphenyl)-2-propen-1-yl]amino]-benzoic acid;N-(4-Pentylcinnamoyl)anthranilic acid;GAMRBCZMOOMBSQ-CCEZHUSRSA-N;2-[3-(4-pentylphenyl)prop-2-enoylamino]benzoic acid;N-(p-Amylcinnamoyl)anthranilic acid >=98% (HPLC);Benzoic acid, 2-[[(2E)-1-oxo-3-(4-pentylphenyl)-2-propen-1-yl]amino]- | | CAS: | 99196-74-4 | | MF: | C21H23NO3 | | MW: | 337.41 | | EINECS: | | | Product Categories: | | | Mol File: | 99196-74-4.mol |  |
| Boiling point | 563.1±50.0 °C(Predicted) | | density | 1.178±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMSO: ≥20mg/mL | | pka | 3.46±0.36(Predicted) | | form | powder | | color | white to off-white | | InChI | 1S/C21H23NO3/c1-2-3-4-7-16-10-12-17(13-11-16)14-15-20(23)22-19-9-6-5-8-18(19)21(24)25/h5-6,8-15H,2-4,7H2,1H3,(H,22,23)(H,24,25)/b15-14+ | | InChIKey | GAMRBCZMOOMBSQ-CCEZHUSRSA-N | | SMILES | CCCCCc1ccc(\C=C\C(=O)Nc2ccccc2C(O)=O)cc1 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| Uses | N-(p-Amylcinnamoyl)anthranilic acid has been used as a transient receptor potential cation channel subfamily M member 2 (TRPM2) inhibitor, in studying its role in regulating the production of reactive oxygen species (ROS). | | Definition | ChEBI: N-(p-amylcinnamoyl)anthranilic acid is an amidobenzoic acid that is anthranilic acid in which one of the anilino hydrogens is replaced by a 4-pentylcinnamoyl group. It is a transient receptor potential (TRP) channel blocker and phospholipase A2 (PLA2) inhibitor. It has a role as an EC 3.1.1.4 (phospholipase A2) inhibitor and a TRP channel blocker. It is an amidobenzoic acid, a member of cinnamamides and a secondary carboxamide. | | General Description | N-(p-Amylcinnamoyl)anthranilic acid (ACA) functions as a broad spectrum phospholipase A2 inhibitor and blocks transient receptor potential (TRP) channels. It inhibits calcium activated chloride current in cardiac ventricular myocytes. ACA regulates various ion channels. | | Biochem/physiol Actions | Broad spectrum phospholipase A2 (PLA2) inhibitor and TRP channel blocker. |
| | ACA Preparation Products And Raw materials |
|