2,3,5-TRIIODOBENZALDEHYDE manufacturers
|
| | 2,3,5-TRIIODOBENZALDEHYDE Basic information |
| | 2,3,5-TRIIODOBENZALDEHYDE Chemical Properties |
| Melting point | 134-138 °C | | Boiling point | 413.1±45.0 °C(Predicted) | | density | 2.891±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C7H3I3O/c8-5-1-4(3-11)7(10)6(9)2-5/h1-3H | | InChIKey | ROJLASMOZHOOOX-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(I)=CC(I)=C1I |
| | 2,3,5-TRIIODOBENZALDEHYDE Usage And Synthesis |
| Uses | 2,3,5-Triiodobenzaldehyde is a halogenated benzaldehyde compound in which the hydrogen atoms at the 2, 3, and 5 positions of the benzene ring are replaced by iodine atoms. It can be used to prepare other halogenated compounds through substitution reactions. |
| | 2,3,5-TRIIODOBENZALDEHYDE Preparation Products And Raw materials |
|