| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Benzenesulfonyl fluoride, 2,3-dichloro- Basic information |
| | Benzenesulfonyl fluoride, 2,3-dichloro- Chemical Properties |
| Melting point | 60-65 °C | | Boiling point | 289.6±30.0 °C(Predicted) | | density | 1.590±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C6H3Cl2FO2S/c7-4-2-1-3-5(6(4)8)12(9,10)11/h1-3H | | InChIKey | FNXHXUGJBKXHFS-UHFFFAOYSA-N | | SMILES | ClC1=C(S(=O)(F)=O)C=CC=C1Cl |
| WGK Germany | WGK 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Benzenesulfonyl fluoride, 2,3-dichloro- Usage And Synthesis |
| Uses | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. | | reaction suitability | reaction type: click chemistry |
| | Benzenesulfonyl fluoride, 2,3-dichloro- Preparation Products And Raw materials |
|