| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 3-(3,4-Dimethoxy-benzyl)-piperidine hydrochloride Basic information |
| | 3-(3,4-Dimethoxy-benzyl)-piperidine hydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C14H21NO2.ClH/c1-16-13-6-5-11(9-14(13)17-2)8-12-4-3-7-15-10-12;/h5-6,9,12,15H,3-4,7-8,10H2,1-2H3;1H | | InChIKey | LJZZULFLDJDCCR-UHFFFAOYSA-N | | SMILES | COC1=C(OC)C=CC(CC2CNCCC2)=C1.Cl |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-(3,4-Dimethoxy-benzyl)-piperidine hydrochloride Usage And Synthesis |
| | 3-(3,4-Dimethoxy-benzyl)-piperidine hydrochloride Preparation Products And Raw materials |
|