- AMPPD
-
- $35.00 / 5mg
-
2026-02-27
- CAS:122341-56-4
- Min. Order:
- Purity: 98.43%
- Supply Ability: 10g
- AMPPD
-
- $35.00 / 5mg
-
2026-02-27
- CAS:122341-56-4
- Min. Order:
- Purity: 98.43%
- Supply Ability: 10g
- AMPPD
-
- $10.00 / 1KG
-
2026-01-30
- CAS:122341-56-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | AMPPD Basic information | | Uses |
| Product Name: | AMPPD | | Synonyms: | 3-(2'-SPIROADAMANTANE)-4-METHOXY-4-(3'-PHOSPHORYLOXY)PHENYL-1,2-DIOXETANE;3-(4-methoxyspiro(1,2-dioxetane-3,2'-tricyclo(3.3.1.1(3,7))decan)-4-yl)phenyl phosphate;4-Methoxy-4-(3-phosphatephenyl)spiro(1,2-dioxetane)-3,2'-adamantane;amppd;3-(2'-Spiroadamantan;(3-[2-Spiroadamatane]-4-Methoxy-4-[3-Phosphoryloxy]-Phenyl-1,2-Dioxetane) Dioxetane;Dia0001(3-[2-Spiroadamatane]-4-Methoxy-4-[3-.Phosphoryloxy]-Ph;Phenol,3-(4-methoxyspiro[1,2-dioxetane-3,2'-tricyclo[3.3.1.13,7]decan]-4-yl)-,1-(dihydrogen phosphate) | | CAS: | 122341-56-4 | | MF: | C18H23O7P | | MW: | 382.34 | | EINECS: | 2017-001-1 | | Product Categories: | | | Mol File: | 122341-56-4.mol |  |
| | AMPPD Chemical Properties |
| Boiling point | 548.6±60.0 °C(Predicted) | | density | 1.47±0.1 g/cm3(Predicted) | | form | Solid | | pka | 1.21±0.30(Predicted) | | color | White to off-white | | InChI | InChI=1S/C18H23O7P/c1-22-18(13-3-2-4-16(10-13)23-26(19,20)21)17(24-25-18)14-6-11-5-12(8-14)9-15(17)7-11/h2-4,10-12,14-15H,5-9H2,1H3,(H2,19,20,21) | | InChIKey | XYIPYISRNJUPBA-UHFFFAOYSA-N | | SMILES | C1(OP(O)(O)=O)=CC=CC(C2(OC)OOC32C2CC4CC3CC(C4)C2)=C1 | | CAS DataBase Reference | 122341-56-4 |
| | AMPPD Usage And Synthesis |
| Uses | 3-(2'-Spiroadamantane)-4-methoxy-4-(3''-phosphoryloxy)phenyl-1,2-dioxetane is a hydrocarbon derivative and can be used as a chemiluminescent reagent. | | Uses | AMPPD, a 1,2-dioxo-cyclohexane derivative, is a biochemistry ultrasensitive alkaline phosphatase substrate. |
| | AMPPD Preparation Products And Raw materials |
|