| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Urapidil Impurity 36
CAS:140456-02-6
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Urapidil Impurity 62
CAS:140456-02-6
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Jinan blalong chemical co. LTD
|
| Tel: |
2710913286@.com |
| Email: |
1513643261@qq.com |
| Products Intro: |
Product Name:UrapidilImpurity27DiHCl
CAS:140456-02-6
Purity:99% HPLC Package:50G;10G;1G;500MG;100MG
|
|
| | 1,3-Propanediamine, N1-(3-chloropropyl)- Basic information |
| Product Name: | 1,3-Propanediamine, N1-(3-chloropropyl)- | | Synonyms: | 1,3-Propanediamine, N1-(3-chloropropyl)-;N1-(3-chloropropyl)propane-1,3-diamine;Roxatidine Impurity 28;Urapidil Impurity 27 DiHCl;Urapidil Impurity 62;Pafolacianine Impurity 21;Roxatidine Impurity 12 | | CAS: | 140456-02-6 | | MF: | C6H15ClN2 | | MW: | 150.65 | | EINECS: | | | Product Categories: | | | Mol File: | 140456-02-6.mol |  |
| | 1,3-Propanediamine, N1-(3-chloropropyl)- Chemical Properties |
| Boiling point | 237.4±20.0 °C(Predicted) | | density | 0.994±0.06 g/cm3(Predicted) | | pka | 10.18±0.10(Predicted) |
| | 1,3-Propanediamine, N1-(3-chloropropyl)- Usage And Synthesis |
| | 1,3-Propanediamine, N1-(3-chloropropyl)- Preparation Products And Raw materials |
|