|
|
| | N-[3-(dimethylamino)propyl]myristamide Basic information |
| | N-[3-(dimethylamino)propyl]myristamide Chemical Properties |
| Melting point | 49-51°C | | Boiling point | 208-215 °C(Press: 1-2 Torr) | | density | 0.879 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 16.29±0.46(Predicted) | | form | Solid | | color | White to Off-White | | Cosmetics Ingredients Functions | ANTISTATIC | | Cosmetic Ingredient Review (CIR) | N-[3-(dimethylamino)propyl]myristamide (45267-19-4) | | InChI | InChI=1S/C19H40N2O/c1-4-5-6-7-8-9-10-11-12-13-14-16-19(22)20-17-15-18-21(2)3/h4-18H2,1-3H3,(H,20,22) | | InChIKey | IFYDWYVPVAMGRO-UHFFFAOYSA-N | | SMILES | C(NCCCN(C)C)(=O)CCCCCCCCCCCCC | | LogP | 5.580 (est) | | EPA Substance Registry System | Tetradecanamide, N-[3-(dimethylamino)propyl]- (45267-19-4) |
| | N-[3-(dimethylamino)propyl]myristamide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Myristamidopropyl dimethylamine (MAPD), present as Aldox in Opti-Free Express Disinfecting Solution for contact lens care, was tested for its potential as a drug in treatment of Acanthamoeba keratitis. MAPD is an amidoamine compound that shows activity against Acanthamoeba as well as a variety of other causal agents of microbial keratitis. |
| | N-[3-(dimethylamino)propyl]myristamide Preparation Products And Raw materials |
|