|
|
| | Myristoyl chloride Basic information |
| | Myristoyl chloride Chemical Properties |
| Melting point | -1 °C (lit.) | | Boiling point | 250 °C/100 mmHg (lit.) | | density | 0.908 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.449(lit.) | | Fp | >230 °F | | storage temp. | −20°C | | form | Liquid | | color | Clear colorless to light yellow-brown | | Water Solubility | MAY DECOMPOSE | | BRN | 636924 | | InChI | InChI=1S/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3 | | InChIKey | LPWCRLGKYWVLHQ-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)CCCCCCCCCCCCC | | CAS DataBase Reference | 112-64-1(CAS DataBase Reference) | | NIST Chemistry Reference | Myristoyl chloride(112-64-1) | | EPA Substance Registry System | Tetradecanoyl chloride (112-64-1) |
| Hazard Codes | C | | Risk Statements | 34-37-22 | | Safety Statements | 26-36/37/39-45-28B | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Met. Corr. 1
Skin Corr. 1B |
| | Myristoyl chloride Usage And Synthesis |
| Chemical Properties | Clear colorless to light yellowish-brown liquid | | Uses | It was used in the synthesis of 6-azafulleroid-6-deoxy-2,3-di-O-myristoylcellulose1 and was used in N-acylation of chitosan to introduce hydrophobicity for use as matrix for drug delivery;
Myristoyl chloride was used in the synthesis of semi-crystalline dendritic poly(ether-amide) derivatives. | | Uses | Myristoyl chloride was used in the synthesis of 6-azafulleroid-6-deoxy-2,3-di-O-myristoylcellulose. It was used in N-acylation of chitosan to introduce hydrophobicity for use as matrix for drug delivery. It was used in the synthesis of semi-crystalline dendritic poly(ether-amide) derivatives. |
| | Myristoyl chloride Preparation Products And Raw materials |
|