| Company Name: |
Tcichem, Inc. |
| Tel: |
13918644899 |
| Email: |
81587635@qq.com |
ethyl cyclopentanecarboxylate manufacturers
|
| | ethyl cyclopentanecarboxylate Basic information |
| Product Name: | ethyl cyclopentanecarboxylate | | Synonyms: | ethyl cyclopentanecarboxylate;Cyclopentane-1-carboxylic acid ethyl ester;Ethyl cylcopentanecarboxylate;cyclopentanethyl formate | | CAS: | 5453-85-0 | | MF: | C8H14O2 | | MW: | 142.2 | | EINECS: | 226-699-4 | | Product Categories: | 1 | | Mol File: | 5453-85-0.mol |  |
| | ethyl cyclopentanecarboxylate Chemical Properties |
| Melting point | 109 °C | | Boiling point | 172-174 °C(Press: 752 Torr) | | density | 0.9583 g/cm3 | | refractive index | 1.43 | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H14O2/c1-2-10-8(9)7-5-3-4-6-7/h7H,2-6H2,1H3 | | InChIKey | UWSJCCUODNDXOT-UHFFFAOYSA-N | | SMILES | C1(C(OCC)=O)CCCC1 |
| RIDADR | UN1993 | | HazardClass | 3 |
| | ethyl cyclopentanecarboxylate Usage And Synthesis |
| | ethyl cyclopentanecarboxylate Preparation Products And Raw materials |
|