- 1,1-diethoxyoctane
-
- $1.00
-
2024-10-22
- CAS:54889-48-4
- Min. Order: 1g
- Purity: 85.0-99.8%
- Supply Ability: 20ton
|
| | 1,1-diethoxyoctane Basic information |
| Product Name: | 1,1-diethoxyoctane | | Synonyms: | 1,1-diethoxyoctane;Octanaldiethylacetal;n-Octanal Diethyl Acetal;n-Octanal Diethyl Acetal;n-OctanalDiethylAcetal>;n-Octyl Aldehyde Diethyl Acetal;Octane, 1,1-diethoxy- | | CAS: | 54889-48-4 | | MF: | C12H26O2 | | MW: | 202.33 | | EINECS: | 259-385-0 | | Product Categories: | | | Mol File: | 54889-48-4.mol |  |
| | 1,1-diethoxyoctane Chemical Properties |
| Boiling point | 115°C/20mmHg(lit.) | | density | 0.832 g/cm3(Temp: 19 °C) | | refractive index | 1.4160 to 1.4200 | | solubility | Practically insoluble in water, soluble in alcohol and oils | | form | clear liquid | | color | Colorless to Almost colorless | | Odor | at 100.00 %. green citrus oily fatty woody spicy fruity | | Odor Type | green | | InChI | InChI=1S/C12H26O2/c1-4-7-8-9-10-11-12(13-5-2)14-6-3/h12H,4-11H2,1-3H3 | | InChIKey | BRKIPAWFUDCCOO-UHFFFAOYSA-N | | SMILES | C(OCC)(OCC)CCCCCCC | | LogP | 4.079 (est) | | CAS DataBase Reference | 54889-48-4 | | NIST Chemistry Reference | Octane, 1,1-diethoxy-(54889-48-4) | | EPA Substance Registry System | Octane, 1,1-diethoxy- (54889-48-4) |
| RIDADR | UN 1993 3/PG III | | TSCA | TSCA listed | | HS Code | 2911.00.5000 | | HazardClass | 3 | | PackingGroup | III |
| | 1,1-diethoxyoctane Usage And Synthesis |
| Uses | 1,1-diethoxyoctane has been suggested for use in
perfume compositions as a modifier for woodyfloral ingredients in Lilac, Muguet, etc. or as
part of the fresh topnote where Cognac oil or
similar ingredients are used. | | Production Methods | 1,1-diethoxyoctane can be produced 1) from Ethyl alcohol and Octaldehyde by
condensation.
2) from Heptylmagnesium bromide and
Ethyl orthoformate. | | Synthesis Reference(s) | Tetrahedron Letters, 25, p. 3075, 1984 DOI: 10.1016/0040-4039(84)80011-8 |
| | 1,1-diethoxyoctane Preparation Products And Raw materials |
|