| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,6-Dimethyloctane Basic information |
| Product Name: | 2,6-Dimethyloctane | | Synonyms: | octane,2,6-dimethyl-;tetrahydrocitronellene;2,6-DIMETHYLOCTANE 95+%;2,6-Dimethyloctane >;2,6-Dimethyloctane in isooctane;dimethyloctane;Octane, 2,6-dimethyl-;2,6-Dimethyloctane | | CAS: | 2051-30-1 | | MF: | C10H22 | | MW: | 142.28 | | EINECS: | | | Product Categories: | | | Mol File: | 2051-30-1.mol |  |
| | 2,6-Dimethyloctane Chemical Properties |
| Melting point | -53.15°C | | Boiling point | 158°C | | density | 0,73 g/cm3 | | refractive index | 1.3990-1.4130 | | Fp | 34°C | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | 89.16ug/L(temperature not stated) | | Henry's Law Constant | 1.0×10-6 mol/(m3Pa) at 25℃, Yaws (2003) | | InChI | InChI=1S/C10H22/c1-5-10(4)8-6-7-9(2)3/h9-10H,5-8H2,1-4H3 | | InChIKey | ZALHPSXXQIPKTQ-UHFFFAOYSA-N | | SMILES | CC(C)CCCC(C)CC | | LogP | 5.490 (est) | | CAS DataBase Reference | 2051-30-1(CAS DataBase Reference) | | EPA Substance Registry System | Octane, 2,6-dimethyl- (2051-30-1) |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | 3295 | | HS Code | 2901.10.5000 | | HazardClass | 3 | | PackingGroup | III |
| | 2,6-Dimethyloctane Usage And Synthesis |
| Chemical Properties | 2,6-Dimethyloctane is a colourless, transparent liquid compound with a density of 0.73 g/mL3, a boiling point of 158° C, a flash point of 34 °C, soluble in ethanol and stored at room temperature. | | Uses | 2,6-Dimethyloctane is used as a diesel fuel additive and as a chemical reaction reagent or product. Optically active 6-chloro-2,6-dimethyloctane is capable of being reduced to 2,6-dimethyloctane in alkali metal solutions in liquid ammonia, and its primary configuration remains unchanged[1-2]. | | Uses | Myrcane is a useful synthetic intermediate. It was used to synthesize alcohols via C-H hydroxylation of alicyclic and aliphatics compounds. | | References | [1] NOAH I. TRACY. Hydrogenated monoterpenes as diesel fuel additives[J]. Fuel, 2009. DOI:10.1016/j.fuel.2009.02.002.
[2] P. E. VERKADE B. M W K D Vries. Reactions of aliphatic halides with solutions of alkali metals in liquid ammonia: III. The reduction of optically active 6‐chloro‐2,6‐dimethyloctane to the corresponding hydrocarbon[J]. Recueil des Travaux Chimiques des Pays-Bas, 2010. DOI:10.1002/RECL.19640830406.
|
| | 2,6-Dimethyloctane Preparation Products And Raw materials |
|