|
|
| Product Name: | (quinolin-8-olato)lithium | | Synonyms: | (quinolin-8-olato)lithium;8-Quinolyloxylithium;Lithium 8-quinolineolate;Lithium quinoline-8-olate;(8-Quinolinolato)lithium;ato)L;8-Quinolinolato lithium (Liq);8-Quinolinol, lithium salt (1:1) | | CAS: | 25387-93-3 | | MF: | C9H7NO.Li | | MW: | 152.1 | | EINECS: | 246-932-3 | | Product Categories: | 1 | | Mol File: | 25387-93-3.mol |  |
| | (quinolin-8-olato)lithium Chemical Properties |
| Melting point | 368 °C | | storage temp. | Store at room temperature, keep dry and cool | | form | powder to crystal | | InChI | 1S/C9H7NO.Li/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H;/q;+1/p-1 | | InChIKey | FQHFBFXXYOQXMN-UHFFFAOYSA-M | | SMILES | [Li+].n1c2c(ccc1)cccc2[O-] | | CAS DataBase Reference | 25387-93-3 | | color | Light yellow powder | | Absorption | λmax261 nm (in THF) |
| WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids |
| | (quinolin-8-olato)lithium Usage And Synthesis |
| Classification | Electron transport-layer (ETL) materials, Organic Light-Emitting Diodes, Organic electronics, Sublimed materials. | | Applications | 8-Hydroxyquinolinolato-lithium (Liq), coupled with aluminium (Al), is commonly used as an electron injection layer (EIL) material in organic electronic devices, particularly OLEDs. Normally, only a very thin layer (1-2 nm) Liq is needed for efficient electron injection from the electrode to the electron transport layer (ETL).
Liq/Al has also been widely known to be an effective cathode system towards general electron transport layer materials. It has also been reported that ultrathin Liq interlayers can greatly enhance the operational stability of light-emitting diodes.
| | Description | 8-Hydroxyquinolinolato-lithium (Liq), coupled with aluminium (Al), is commonly used as an electron injection layer (EIL) material in organic electronic devices, particularly OLEDs. Normally, only a very thin layer (1-2 nm) Liq is needed for efficient electron injection from the electrode to the electron transport layer (ETL). | | General Description | Electron transport and hole blocking material in organic light emitting diodes (OLED). |
| | (quinolin-8-olato)lithium Preparation Products And Raw materials |
|