5-pentadecylresorcinol manufacturers
- Adipostatin A
-
- $2.20 / 100kg
-
2025-10-13
- CAS:3158-56-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | 5-pentadecylresorcinol Basic information |
| Product Name: | 5-pentadecylresorcinol | | Synonyms: | cardol;5-N-PENTADECYLRESORCINOL;5-PENTADECYL-1,3-BENZENEDIOL);Adipostatin A;1,3-Benzenediol, 5-pentadecyl-;Einecs 221-599-7;Nsc 776;Resorcinol, 5-pentadecyl | | CAS: | 3158-56-3 | | MF: | C21H36O2 | | MW: | 320.51 | | EINECS: | 221-599-7 | | Product Categories: | | | Mol File: | 3158-56-3.mol |  |
| | 5-pentadecylresorcinol Chemical Properties |
| Melting point | 89-90 °C | | Boiling point | 452.5±15.0 °C(Predicted) | | density | 0.960±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF: soluble; DMSO: soluble; Ethanol: soluble; Methanol: soluble | | pka | 9.55±0.10(Predicted) | | form | Solid | | color | Off-white to light yellow | | BRN | 1982742 | | InChI | InChI=1S/C21H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-20(22)18-21(23)17-19/h16-18,22-23H,2-15H2,1H3 | | InChIKey | KVVSCMOUFCNCGX-UHFFFAOYSA-N | | SMILES | C1(O)=CC(CCCCCCCCCCCCCCC)=CC(O)=C1 | | EPA Substance Registry System | 1,3-Benzenediol, 5-pentadecyl- (3158-56-3) |
| Hazard Codes | Xi | | Risk Statements | 41-43 | | Safety Statements | 26-36/37-39 | | WGK Germany | 3 | | TSCA | TSCA listed |
| | 5-pentadecylresorcinol Usage And Synthesis |
| Uses | 5-Pentadecylresorcinol is one of the major active components in wheat bran with inhibitory activity against colon cancer cell growth. 5-Pentadecylresorcinol also has antioxidant activity and protective effects on cell viability of PC-12 AC cells. | | Definition | ChEBI: Resorcinol substituted at position 5 by a pentadecyl chain. |
| | 5-pentadecylresorcinol Preparation Products And Raw materials |
|