| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Metolachlor OA Pestanal Basic information |
| Product Name: | Metolachlor OA Pestanal | | Synonyms: | Metolachlor OA Pestanal;N-(2-Ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)oxalamic acid, [(2-Ethyl-6-methylphenyl)(2-methoxy-1-methylethyl)amino]oxo-acetic acid;Metolachlor oxanilic acid (OA);Acetic acid, 2-[(2-ethyl-6-methylphenyl)(2-methoxy-1-methylethyl)amino]-2-oxo-;(rac)-Metolachlor Metabolite CGA 351916;C15171200 Metolachlor oxaniliCacid (OA);Metolachlor OA 10 μg/ml Acetonitrile;Metolachlor OA 100 μg/ml Acetonitrile | | CAS: | 152019-73-3 | | MF: | C15H21NO4 | | MW: | 279.33 | | EINECS: | | | Product Categories: | | | Mol File: | 152019-73-3.mol |  |
| | Metolachlor OA Pestanal Chemical Properties |
| Boiling point | 411.4±55.0 °C(Predicted) | | density | 1.158±0.06 g/cm3(Predicted) | | solubility | Chloroform (Slightly), DMSO (Slightly) | | pka | 0.05±0.54(Predicted) | | Major Application | agriculture
environmental | | InChI | 1S/C15H21NO4/c1-5-12-8-6-7-10(2)13(12)16(11(3)9-20-4)14(17)15(18)19/h6-8,11H,5,9H2,1-4H3,(H,18,19) | | InChIKey | LNOOSYCKMKZOJB-UHFFFAOYSA-N | | SMILES | CCc1cccc(C)c1N(C(C)COC)C(=O)C(O)=O | | EPA Substance Registry System | Acetic acid, 2-[(2-ethyl-6-methylphenyl)(2-methoxy-1-methylethyl)amino]-2-oxo- (152019-73-3) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Metolachlor OA Pestanal Usage And Synthesis |
| Uses | Metolachlor OA is a derivative of Metolachlor (M338700), a selective pre-emergence herbicide. Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA), environmental, and food contaminants. | | Definition | ChEBI: [(2-ethyl-6-methylphenyl)(1-methoxypropan-2-yl)amino](oxo)acetic acid is a monocarboxylic acid that is oxoacetic acid substituted by a (2-ethyl-6-methylphenyl)(1-methoxypropan-2-yl)amino group at position 2. It is an aromatic amide, an ether and a monocarboxylic acid. | | reaction suitability | reagent type: derivatization reagent
reaction type: Silylations |
| | Metolachlor OA Pestanal Preparation Products And Raw materials |
|