| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Nitro-4-(trifluoromethyl)benzaldehyde Basic information |
| Product Name: | 2-Nitro-4-(trifluoromethyl)benzaldehyde | | Synonyms: | 2-Nitro-4-(trifluoromethyl)benzaldehyde 97%;4-Formyl-3-nitrobenzotrifluoride, 2-Formyl-5-(trifluoromethyl)nitrobenzene, 2-Nitro-alpha,alpha,alpha-trifluoro-p-tolualdehyde;Benzaldehyde, 2-nitro-4-(trifluoromethyl)-;2-nitro-4-(trifluoromethyl)benzaldehyde - [N81351] | | CAS: | 109466-87-7 | | MF: | C8H4F3NO3 | | MW: | 219.12 | | EINECS: | | | Product Categories: | | | Mol File: | 109466-87-7.mol |  |
| | 2-Nitro-4-(trifluoromethyl)benzaldehyde Chemical Properties |
| Melting point | 41-45°C | | Boiling point | 273.8±40.0 °C(Predicted) | | density | 1.496±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | Light yellow to brown Solid | | InChI | 1S/C8H4F3NO3/c9-8(10,11)6-2-1-5(4-13)7(3-6)12(14)15/h1-4H | | InChIKey | CTSYMGKKRHIYIH-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(ccc1C=O)C(F)(F)F | | CAS DataBase Reference | 109466-87-7 |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Sens. 1 |
| | 2-Nitro-4-(trifluoromethyl)benzaldehyde Usage And Synthesis |
| Uses | 2-Nitro-4-trifluoromethylbenzaldehyde is an o-nitrobenzaldehyde compound and an important pharmaceutical intermediate. It can be used as a raw material for synthesizing drugs for treating cardiovascular diseases such as nitropyridine (Adalat), nisodipine, and encaine. It is also an important organic synthesis raw material with wide applications in the chemical industry. | | Pharmaceutical Applications | 2-Nitro-4-(Trifluoromethyl)benzaldehyde is used as a chemical
intermediate for the synthesis of various pharmaceuticals. Its unique
structure allows for the development of new drug molecules with
potential therapeutic applications. |
| | 2-Nitro-4-(trifluoromethyl)benzaldehyde Preparation Products And Raw materials |
|