| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-Carboxyadamantane-1-acetic acid Basic information |
| | 3-Carboxyadamantane-1-acetic acid Chemical Properties |
| Melting point | 91-95 °C | | density | 1.374±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | form | powder | | InChI | 1S/C13H18O4/c14-10(15)6-12-2-8-1-9(3-12)5-13(4-8,7-12)11(16)17/h8-9H,1-7H2,(H,14,15)(H,16,17)/t8-,9+,12-,13- | | InChIKey | YQXJBYAQGPMUEP-PUKADYQLSA-N | | SMILES | OC(=O)C[C@]12C[C@@H]3C[C@H](C1)CC(C3)(C2)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-52/53 | | Safety Statements | 61 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Carboxyadamantane-1-acetic acid Usage And Synthesis |
| | 3-Carboxyadamantane-1-acetic acid Preparation Products And Raw materials |
|