- Methyl 4-chlorophenylacetate
-
- $5.00 / 1KG
-
2025-09-25
- CAS:52449-43-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | Methyl 4-chlorophenylacetate Basic information |
| Product Name: | Methyl 4-chlorophenylacetate | | Synonyms: | METHYL 4-CHLOROPHENYLACETATE;AURORA KA-6004;ASISCHEM D13373;4-Chlovophenylacetic acid Methyl ester;4 - chlorobenzene Methyl acetate;(4-CHLORO-PHENYL)-ACETIC ACID METHYL ESTER;methyl 2-(4-chlorophenyl)acetate;Methyl p-chlorophenylacetate | | CAS: | 52449-43-1 | | MF: | C9H9ClO2 | | MW: | 184.62 | | EINECS: | 257-927-0 | | Product Categories: | Aromatic Esters;bc0001 | | Mol File: | 52449-43-1.mol |  |
| | Methyl 4-chlorophenylacetate Chemical Properties |
| Boiling point | 115 °C / 6mmHg | | density | 1.20 | | refractive index | 1.522-1.524 | | Fp | 250 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, DCM, Methanol | | form | Liquid | | color | Clear slightly yellow | | InChI | InChI=1S/C9H9ClO2/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-5H,6H2,1H3 | | InChIKey | WWIYGBWRUXQDND-UHFFFAOYSA-N | | SMILES | C1(CC(OC)=O)=CC=C(Cl)C=C1 | | CAS DataBase Reference | 52449-43-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzeneacetic acid, 4-chloro-, methyl ester(52449-43-1) |
| Provider | Language |
|
ACROS
| English |
| | Methyl 4-chlorophenylacetate Usage And Synthesis |
| Chemical Properties | clear slightly yellow liquid | | Uses | (4-Chlorophenyl)acetic Acid Methyl Ester is an intermediate in the synthesis of 4-Chloro-N-(2-hydroxypropyl)benzeneacetamide (C368125), a reagent in the synthesis of Lorcaserin Hydrochloride (L469890). |
| | Methyl 4-chlorophenylacetate Preparation Products And Raw materials |
|