2,4,5-Trimethoxylproriophenone manufacturers
|
| | 2,4,5-Trimethoxylproriophenone Basic information |
| Product Name: | 2,4,5-Trimethoxylproriophenone | | Synonyms: | 1-(2,4,5-TRIMETHOXYPHENYL)PROPAN-1-ONE;2,4,5-TRIMETHOXYLPROPRIOPHENONE;isoacoramone;1-Propanone, 1-(2,4,5-trimethoxyphenyl)-;Asarone Impurity 1;2,4,5-trimethoxyphenyl)propan-1-one;2,4,5-Trimethoxylproriophenone | | CAS: | 3904-18-5 | | MF: | C12H16O4 | | MW: | 224.25 | | EINECS: | | | Product Categories: | | | Mol File: | 3904-18-5.mol |  |
| | 2,4,5-Trimethoxylproriophenone Chemical Properties |
| Melting point | 108.5-109.5 °C | | Boiling point | 342.4±37.0 °C(Predicted) | | density | 1.070±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C12H16O4/c1-5-9(13)8-6-11(15-3)12(16-4)7-10(8)14-2/h6-7H,5H2,1-4H3 | | InChIKey | KUQHFNICKXWOBZ-UHFFFAOYSA-N | | SMILES | C(C1=CC(OC)=C(OC)C=C1OC)(=O)CC |
| | 2,4,5-Trimethoxylproriophenone Usage And Synthesis |
| Preparation | Preparation from 1,2,4-trimethoxybenzene by reaction,
with propionic anhydride catalyzed either by iodine or aluminium chloride;
with propionyl chloride in the presence of aluminium chloride in methylene chloride at 10° for 1 h (80%)or in carbon disulfide (67%). | | Definition | ChEBI: Isoacoramone is an aromatic ketone. |
| | 2,4,5-Trimethoxylproriophenone Preparation Products And Raw materials |
|