- (S)-Glyceraldehyde acetonide
-
- $15.00 / 1KG
-
2021-08-12
- CAS:22323-80-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | (S)-Glyceraldehyde acetonide Basic information |
| Product Name: | (S)-Glyceraldehyde acetonide | | Synonyms: | (S)-2,3-ISOPROPYLIDENE GLYCERALDEHYDE;(s)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde;(S)-GLYCERALDEHYDE ACETONIDE;2,3-O-ISOPROPYLIDENE-L-GLYCERALDEHYDE;1,3-DIOXOLANE-4-CARBOXALDEHYDE, 2,2-DIMETHYL-, (S)-;(S)-Glyceraldehyde acetonide, 50% in DCM;L-GLYCERALDEHYDE ACETONIDE;S-(-)-Solketaldehyde | | CAS: | 22323-80-4 | | MF: | C6H10O3 | | MW: | 130.14 | | EINECS: | 606-982-2 | | Product Categories: | Ring Systems;Aldehydes;API intermediates | | Mol File: | 22323-80-4.mol |  |
| | (S)-Glyceraldehyde acetonide Chemical Properties |
| Boiling point | 42-44 °C(Press: 13 Torr) | | density | 1.123±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C6H10O3/c1-6(2)8-4-5(3-7)9-6/h3,5H,4H2,1-2H3/t5-/m1/s1 | | InChIKey | YSGPYVWACGYQDJ-RXMQYKEDSA-N | | SMILES | O1C[C@@H](C=O)OC1(C)C | | CAS DataBase Reference | 22323-80-4(CAS DataBase Reference) |
| | (S)-Glyceraldehyde acetonide Usage And Synthesis |
| Uses | (4S)-2,2-Dimethyl-1,3-dioxolane-4-carbaldehyde is a heterocyclic compound used in organic synthesis. |
| | (S)-Glyceraldehyde acetonide Preparation Products And Raw materials |
|