| Company Name: |
Clickchem Research LLP
|
| Tel: |
+91-8140031133 |
| Email: |
mayur@clickchemresearch.com |
| Products Intro: |
Product Name:1-(4-CHLOROMETHYL-2-THIAZOYL)GUANIDINE HYDROCHLORIDE CAS:69014-12-6 Purity:90 % Above Package:25 mg, 100 mg, 250 mg, 500 mg and 1.0 gm
|
|
| | [4-(Chloromethyl)-2-thiazolyl] Guanidine mono hydrochloride Basic information |
| | [4-(Chloromethyl)-2-thiazolyl] Guanidine mono hydrochloride Chemical Properties |
| Melting point | 181-187°C | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Brown | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C5H7ClN4S.ClH/c6-1-3-2-11-5(9-3)10-4(7)8;/h2H,1H2,(H4,7,8,9,10);1H | | InChIKey | HPXWWLGOFMSKHV-UHFFFAOYSA-N | | SMILES | C1(SC=C(CCl)N=1)NC(N)=N.Cl | | CAS DataBase Reference | 69014-12-6 |
| | [4-(Chloromethyl)-2-thiazolyl] Guanidine mono hydrochloride Usage And Synthesis |
| Chemical Properties | Pale Beige Solid | | Uses | [4-(Chloromethyl)-2-thiazolyl] Guanidine mono hydrochloride is a reagent used to produce many guanidine based pharmaceuticals. |
| | [4-(Chloromethyl)-2-thiazolyl] Guanidine mono hydrochloride Preparation Products And Raw materials |
|