Pyridine, 5-(chloromethyl)-2-fluoro- (9CI) manufacturers
|
| | Pyridine, 5-(chloromethyl)-2-fluoro- (9CI) Basic information |
| | Pyridine, 5-(chloromethyl)-2-fluoro- (9CI) Chemical Properties |
| Boiling point | 227.0±25.0 °C(Predicted) | | density | 1.270±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | -1.20±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H5ClFN/c7-3-5-1-2-6(8)9-4-5/h1-2,4H,3H2 | | InChIKey | QRXZNFSVRLDKPE-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C(CCl)C=C1 |
| | Pyridine, 5-(chloromethyl)-2-fluoro- (9CI) Usage And Synthesis |
| Uses | 5-(Chloromethyl)-2-fluoropyridine is a derivative of Pyridine (P991280), a basic six-membered heterocyclic ring. Pyridine is a base structure present in many biologically active compounds like the vitamins niacin and pyridoxal. |
| | Pyridine, 5-(chloromethyl)-2-fluoro- (9CI) Preparation Products And Raw materials |
|