2-Acetamido-5-bromotoluene manufacturers
|
| | 2-Acetamido-5-bromotoluene Basic information |
| Product Name: | 2-Acetamido-5-bromotoluene | | Synonyms: | Benzene,2-(chloroMethyl)-4-fluoro-1-Methyl-;2-(Chloromethyl)-4-fluoro-1-methylbenzene, 2-(Chloromethyl)-4-fluorotoluene;2-Methyl-5-fluorobenzyl chloride;2-ACETAMIDO-5-BROMOTOLUENE | | CAS: | 22062-55-1 | | MF: | C8H8ClF | | MW: | 158.6 | | EINECS: | | | Product Categories: | | | Mol File: | 22062-55-1.mol |  |
| | 2-Acetamido-5-bromotoluene Chemical Properties |
| Boiling point | 199℃ | | density | 1.15 | | Fp | 76°(169°F) | | refractive index | 1.5170 | | InChI | InChI=1S/C8H8ClF/c1-6-2-3-8(10)4-7(6)5-9/h2-4H,5H2,1H3 | | InChIKey | MTKSHHODKOMICW-UHFFFAOYSA-N | | SMILES | C1(C)=CC=C(F)C=C1CCl | | CAS DataBase Reference | 22062-55-1 |
| HazardClass | 8 | | HS Code | 2903998090 |
| | 2-Acetamido-5-bromotoluene Usage And Synthesis |
| | 2-Acetamido-5-bromotoluene Preparation Products And Raw materials |
|