|
|
| | Di(1-adamantyl)-n-butylphosphine hydriodide Basic information |
| | Di(1-adamantyl)-n-butylphosphine hydriodide Chemical Properties |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | Powder | | color | white | | Sensitive | light sensitive | | InChI | InChI=1/C24H39P.HI/c1-2-3-4-25(23-11-17-5-18(12-23)7-19(6-17)13-23)24-14-20-8-21(15-24)10-22(9-20)16-24;/h17-22H,2-16H2,1H3;1H/t17-,18+,19-,20-,21+,22-,23-,24-; | | InChIKey | IBXHWLZKSOGUFS-HDWJELNESA-N | | SMILES | [H][C@]12C[C@]3(C[C@](C[C@](C3)(C1)[H])(C2)[H])P(CCCC)[C@]12C[C@@]3(C[C@](C1)(C[C@@](C3)(C2)[H])[H])[H].I |&1:1,3,5,7,18,20,22,25,r| |
| WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | Di(1-adamantyl)-n-butylphosphine hydriodide Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Phosphonium salts are ligand precursors for the palladium-catalyzed amination, and Suzuki coupling | | Uses | suzuki reaction | | General Description | sold in collaboration with Solvias AG | | reaction suitability | reaction type: Asymmetric synthesis reagent type: ligand reaction type: Arylations reagent type: ligand reaction type: Buchwald-Hartwig Cross Coupling Reaction reagent type: ligand reaction type: Suzuki-Miyaura Coupling |
| | Di(1-adamantyl)-n-butylphosphine hydriodide Preparation Products And Raw materials |
|