| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1-(2,4-Dihydroxyphenyl)-2-p-tolylethanone CAS:59208-55-8 Purity:1-(2,4-Dihydroxyphenyl)-2-p-tolylethanone Package:1G Remarks:JRD1390-1G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:1-(2,4-Dihydroxyphenyl)-2-p-tolylethanone CAS:59208-55-8
|
|
| | 1-(2,4-DIHYDROXYPHENYL)-2-P-TOLYLETHANONE Basic information |
| | 1-(2,4-DIHYDROXYPHENYL)-2-P-TOLYLETHANONE Chemical Properties |
| Melting point | 114°C | | form | solid | | InChI | 1S/C15H14O3/c1-10-2-4-11(5-3-10)8-14(17)13-7-6-12(16)9-15(13)18/h2-7,9,16,18H,8H2,1H3 | | InChIKey | QWJBLSOLPSJDRG-UHFFFAOYSA-N | | SMILES | CC1=CC=C(CC(C2=C(O)C=C(O)C=C2)=O)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 1-(2,4-DIHYDROXYPHENYL)-2-P-TOLYLETHANONE Usage And Synthesis |
| Preparation | Obtained by reaction of p-tolylacetonitrile with resorcinol (Hoesch reaction). |
| | 1-(2,4-DIHYDROXYPHENYL)-2-P-TOLYLETHANONE Preparation Products And Raw materials |
|