| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine Basic information |
| Product Name: | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine | | Synonyms: | (S)-(-)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine,min.95%CTH-(S)-Xylyl-P-Phos;(r)-(+)-2,2',6,6'-tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine *cth-(r)-xylyl-p-phos*;(s)-(-)-2,2',6,6'-tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine *cth-(s)-xylyl-p-phos*;(R)-(+)-2,2'',6,6''-TETRAMETHOXY-4,4''-BIS(DI(3,5-XYLYL)PHOSPHINO)-3,3''-BIPYRIDINE *CTH-(R)-XYLYL-P-PHO;(S)-(-)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine, CTH-(S)-Xylyl-P-Phos, 95% Application:Asymmetric hydrogenation Store N2Ar;(S)-(-)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine *CTH-(S)-Xylyl-P-Pho;(3S)-4,4'-Bis[bis(3,5-dimethylphenyl)phosphino]-2,2',6,6'-tetramethoxy-3,3'-bipyridine;(S)-Xyl-P-Phos | | CAS: | 443347-10-2 | | MF: | C46H50N2O4P2 | | MW: | 756.85 | | EINECS: | | | Product Categories: | | | Mol File: | 443347-10-2.mol |  |
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine Chemical Properties |
| Melting point | 158-162°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | white to pale yellow | | Water Solubility | Sparingly soluble in water. | | InChIKey | JRTHAKOHBMETRC-UHFFFAOYSA-N | | SMILES | COc1cc(P(c2cc(C)cc(C)c2)c3cc(C)cc(C)c3)c(c(OC)n1)-c4c(OC)nc(OC)cc4P(c5cc(C)cc(C)c5)c6cc(C)cc(C)c6 | | CAS DataBase Reference | 443347-10-2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine Usage And Synthesis |
| Chemical Properties | White solid | | Uses | (S)-(-)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine is used in Pharmaceutical and industry applications. | | Uses | Ligand employed in the asymmetic hydrogenation of -keto esters, 2-arylacrylates, aryl ketones , and other substrates. | | Reactions |
- Chiral ligand for the asymmetric hydrogenation of β-keto esters.
- Chiral ligand for enantioselective rhodium-catalyzed [2+2+2] carbocyclization reactions.
- Chiral ligand for ruthenium catalyzed hydrogenation of (E)-β-(acylamino)acrylates to β-amino acids.
- The Rhodium complex gives higher enantioselectivity for hydrogenation of (Z)-β-(acylamino)acrylates to β-amino acids.
- Chiral ligand for copper-catalyzed asymmetric hydrosilylation of ketones.
- Chiral ligand for asymmetric allylic substitution reactions using boronic acids as nucleophiles.
- Gives useful selectivity in asymmetric Pauson-Khand-type cyclizations.
 |
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine Preparation Products And Raw materials |
|