| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine Basic information | | Reactions |
| Product Name: | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine | | Synonyms: | CTH-(R)-XYLYL-P-PHOS;CTH-(S)-XYLYL-P-PHOS;(S)-(-)-2,2',6,6'-TETRAMETHOXY-4,4'-BIS(DI(3,5-XYLYL)PHOSPHINO)-3,3'-BIPYRIDINE;(R)-XYLYL-P-PHOS;(S)-XYLYL-P-PHOS;(R)-(+)-2,2',6,6'-TETRAMETHOXY-4,4'-BIS&;min.cth-(r)-xylyl-p-phos;(R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine,min.95%CTH-(R)-Xylyl-P-Phos | | CAS: | 442905-33-1 | | MF: | C46H50N2O4P2 | | MW: | 756.85 | | EINECS: | | | Product Categories: | | | Mol File: | 442905-33-1.mol |  |
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine Chemical Properties |
| Melting point | 190-194°C | | Boiling point | 791.1±60.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | pka | -1.76±0.38(Predicted) | | color | white to pale yellow | | Optical Rotation | [α]20/D +125°, c = 1 in chloroform | | Water Solubility | Sparingly soluble in water. | | InChIKey | JRTHAKOHBMETRC-UHFFFAOYSA-N | | SMILES | COc1cc(P(c2cc(C)cc(C)c2)c3cc(C)cc(C)c3)c(c(OC)n1)-c4c(OC)nc(OC)cc4P(c5cc(C)cc(C)c5)c6cc(C)cc(C)c6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine Usage And Synthesis |
| Reactions |
- Chiral ligand for ruthenium- catalyzed asymmetric hydrogenation of aromatic ketones.
- Chiral ligand for iridium-catalyzed asymmetric hydrogenation of quinolines.
- Chiral ligand for copper- catalyzed asymmetric hydrosilylation of ketones.
- Synthesis of new chiral 2-functionized-1,2,3,4-tetrahydroquinoline derivatives via asymmetric hydrogenation of substituted quinolines.
- Rhodium-biphosphine-catalyzed asymmetric, intermolecular hydroheteroarylation of α-substituted acrylate derivatives.
| | Chemical Properties | White solid | | Uses | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine is used in asymmetric hydrogenation.It acts as a ligand used in the asymmetic hydrogenation of β-keto esters, 2-arylacrylates, aryl ketones , and other substrates. Other applications include it is used widely as a Catalyst, when combined with Rh, Ru and Ir precursor. |
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine Preparation Products And Raw materials |
|