|
|
| | Desmethyl Levofloxacin Basic information |
| Product Name: | Desmethyl Levofloxacin | | Synonyms: | Levofloxacin ImpurityⅢ:LevofloxacinImpurity E{(3S)-9-Fluoro-2,3-dihydro-3-methyl-7-oxo-10-(1-piperazinyl)-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic Acid Hydrochloride};Ofloxacin Impurity II(Impurity E);Levofloxacin Related Compound A(USP);Levofloxacin-1;1,2,3-de>S-(-)-9-fluoro-2,3-dihydro-3-methyl-10-(1-piperazinyl)-7-oxo-7H-pyrido-<(3S)-9-Fluoro-2,3-dihydro-3-methyl-7-oxo-10-(1-piperazinyl)-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic Acid;Desmethyl Levofloxacin | | CAS: | 117707-40-1 | | MF: | C17H18FN3O4 | | MW: | 347.34 | | EINECS: | | | Product Categories: | Chiral Reagents;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 117707-40-1.mol |  |
| | Desmethyl Levofloxacin Chemical Properties |
| Melting point | >184 °C (Dec.) | | Boiling point | 600.7±55.0 °C(Predicted) | | density | 1.51±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Acid (Slightly, Sonicated), Aqueous Base (Slightly, Sonicated), DMSO (Slightly) | | pka | 5.19±0.40(Predicted) | | form | Solid | | color | Pale Yellow | | BRN | 6161512 | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H18FN3O4/c1-9-8-25-16-13-10(15(22)11(17(23)24)7-21(9)13)6-12(18)14(16)20-4-2-19-3-5-20/h6-7,9,19H,2-5,8H2,1H3,(H,23,24)/t9-/m0/s1 | | InChIKey | WKRSSAPQZDHYRV-VIFPVBQESA-N | | SMILES | C[C@H]1COc2c(N3CCNCC3)c(F)cc4C(=O)C(=CN1c24)C(O)=O | | CAS DataBase Reference | 117707-40-1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Desmethyl Levofloxacin Usage And Synthesis |
| Uses | A metabolite of Levofloxacin | | Uses | Desmethyl Levofloxacin is a degradation product of levofloxacin. A levofloxacin impurity with antibacterial properties. | | Definition | ChEBI: Ofloxacin impurity e is a member of quinolines. |
| | Desmethyl Levofloxacin Preparation Products And Raw materials |
|