|
|
| | Metoprolol Acid Basic information |
| | Metoprolol Acid Chemical Properties |
| Melting point | 174-176°C | | Boiling point | 477.1±40.0 °C(Predicted) | | density | 1.159±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly) | | form | Solid | | pka | 4.41±0.10(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C14H21NO4/c1-10(2)15-8-12(16)9-19-13-5-3-11(4-6-13)7-14(17)18/h3-6,10,12,15-16H,7-9H2,1-2H3,(H,17,18) | | InChIKey | PUQIRTNPJRFRCZ-UHFFFAOYSA-N | | SMILES | N(C(C)C)CC(O)COc1ccc(cc1)CC(=O)O | | CAS DataBase Reference | 56392-14-4 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | CY1634360 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 intravenous in dog: > 500mg/kg |
| | Metoprolol Acid Usage And Synthesis |
| Chemical Properties | Off-white Solid | | Uses | The acidic inactive metabolite of Metoprolol | | Uses | 4-(2-Hydroxy-3-isopropylaminopropoxy)phenylacetic acid may be used as an analytical standard for the determination of the analyte in environmental water samples, wastewater samples, and human and animal biological samples by various chromatography techniques. | | Definition | ChEBI: A monocarboxylic acid that is phenylacetic acid substituted by a 2-hydroxy-3-(propan-2-ylamino)propoxy group at position 4. It is a metabolite of the drug atenolol. | | General Description | 4-(2-Hydroxy-3-isopropylaminopropoxy)phenylacetic acid is a metabolite of the selective β-1 blocker drug metoprolol. |
| | Metoprolol Acid Preparation Products And Raw materials |
|