| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | 3-[2-Hydroxy-3-[4-(2-methoxyethyl)phenoxy]propoxy]-1-isopropylamino-2-propanol Basic information |
| | 3-[2-Hydroxy-3-[4-(2-methoxyethyl)phenoxy]propoxy]-1-isopropylamino-2-propanol Chemical Properties |
| Boiling point | 488.4±45.0 °C(Predicted) | | density | 1.092±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 13.47±0.20(Predicted) | | form | Solid | | color | Off-White to Pale | | Major Application | pharmaceutical small molecule | | InChI | 1S/C18H31NO5/c1-14(2)19-10-16(20)11-23-12-17(21)13-24-18-6-4-15(5-7-18)8-9-22-3/h4-7,14,16-17,19-21H,8-13H2,1-3H3 | | InChIKey | SETHZMZYJZUIRG-UHFFFAOYSA-N | | SMILES | OC(COCC(O)CNC(C)C)COC1=CC=C(CCOC)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Lact. |
| | 3-[2-Hydroxy-3-[4-(2-methoxyethyl)phenoxy]propoxy]-1-isopropylamino-2-propanol Usage And Synthesis |
| Uses | 3-[2-Hydroxy-3-[4-(2-methoxyethyl)phenoxy]propoxy]-1-isopropylamino-2-propanol (Metoprolol EP Impurity J) is a new byproduct detected in Metoprolol tartrate (M338790). |
| | 3-[2-Hydroxy-3-[4-(2-methoxyethyl)phenoxy]propoxy]-1-isopropylamino-2-propanol Preparation Products And Raw materials |
|